C41H40F3N4O4P — CID 87987815
[(4S)-4-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-5,5-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]octan-4-yl] carbamate (PubChem CID 87987815) has the molecular formula C41H40F3N4O4P and a molecular weight of 740.76 g/mol. Its IUPAC name is [(4S)-4-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-5,5-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]octan-4-yl] carbamate.
| Compound Name | [(4S)-4-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-5,5-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]octan-4-yl] carbamate |
|---|---|
| PubChem CID | 87987815 |
| Molecular Formula | C41H40F3N4O4P |
| Molecular Weight | 740.76 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | [(4S)-4-[2-cyano-2-(triphenyl-λ5-phosphanylidene)acetyl]-5,5-dimethyl-1-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]octan-4-yl] carbamate |
| SMILES | CCCC(C)(C)[C@](CCCc1nnc(-c2ccc(C(F)(F)F)cc2)o1)(OC(N)=O)C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H40F3N4O4P/c1-4-26-39(2,3)40(52-38(46)50,27-14-21-35-47-48-37(51-35)29-22-24-30(25-23-29)41(42,43)44)36(49)34(28-45)53(31-15-8-5-9-16-31,32-17-10-6-11-18-32)33-19-12-7-13-20-33/h5-13,15-20,22-25H,4,14,21,26-27H2,1-3H3,(H2,46,50)/t40-/m1/s1 |
| InChIKey | KIGVHQAPIWNSCM-RRHRGVEJSA-N |
| XLogP | 8.00 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.76 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|