About 2-phenylhexan-2-ylurea
2-phenylhexan-2-ylurea (PubChem CID 121306915) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-phenylhexan-2-ylurea.
Molecular Properties
| Compound Name | 2-phenylhexan-2-ylurea |
| PubChem CID | 121306915 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-phenylhexan-2-ylurea |
| SMILES | CCCCC(C)(NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O/c1-3-4-10-13(2,15-12(14)16)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H3,14,15,16) |
| InChIKey | BUPNPHMSOXPEHZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylhexan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylhexan-2-ylurea?
The IUPAC name of 2-phenylhexan-2-ylurea (CID 121306915) is 2-phenylhexan-2-ylurea.
What is the SMILES notation for 2-phenylhexan-2-ylurea?
The canonical SMILES for 2-phenylhexan-2-ylurea is CCCCC(C)(NC(N)=O)c1ccccc1.
What is the InChIKey of 2-phenylhexan-2-ylurea?
The InChIKey is BUPNPHMSOXPEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-3-4-10-13(2,15-12(14)16)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H3,14,15,16).
What are the key properties of 2-phenylhexan-2-ylurea?
2-phenylhexan-2-ylurea has a molecular weight of 220.32 g/mol, XLogP of 2.76, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylhexan-2-ylurea is sourced from PubChem (CID 121306915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).