C13H13F3O3S — CID 11120324
(3E)-1,1,1-trifluoro-3-[methylsulfonyl(phenyl)methylidene]pentan-2-one (PubChem CID 11120324) has the molecular formula C13H13F3O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-[methylsulfonyl(phenyl)methylidene]pentan-2-one.
| Compound Name | (3E)-1,1,1-trifluoro-3-[methylsulfonyl(phenyl)methylidene]pentan-2-one |
|---|---|
| PubChem CID | 11120324 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-[methylsulfonyl(phenyl)methylidene]pentan-2-one |
| SMILES | CC/C(C(=O)C(F)(F)F)=C(/c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H13F3O3S/c1-3-10(12(17)13(14,15)16)11(20(2,18)19)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3/b11-10+ |
| InChIKey | UOXCWIPPFYQWLY-ZHACJKMWSA-N |
| XLogP | 2.98 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|