C20H30N2O3S — CID 90963668
1,1'-biphenyl;N,N-dimethylmethanesulfonamide;N,N-dimethylpropanamide (PubChem CID 90963668) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1,1'-biphenyl;N,N-dimethylmethanesulfonamide;N,N-dimethylpropanamide.
| Compound Name | 1,1'-biphenyl;N,N-dimethylmethanesulfonamide;N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 90963668 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1,1'-biphenyl;N,N-dimethylmethanesulfonamide;N,N-dimethylpropanamide |
| SMILES | CCC(=O)N(C)C.CN(C)S(C)(=O)=O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C5H11NO.C3H9NO2S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-5(7)6(2)3;1-4(2)7(3,5)6/h1-10H;4H2,1-3H3;1-3H3 |
| InChIKey | ABYPKCUYZJRBKB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |