C12H10ClF3O2 — CID 10802587
(3Z)-3-[(4-chlorophenyl)-hydroxymethylidene]-1,1,1-trifluoropentan-2-one (PubChem CID 10802587) has the molecular formula C12H10ClF3O2 and a molecular weight of 278.66 g/mol. Its IUPAC name is (3Z)-3-[(4-chlorophenyl)-hydroxymethylidene]-1,1,1-trifluoropentan-2-one.
| Compound Name | (3Z)-3-[(4-chlorophenyl)-hydroxymethylidene]-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 10802587 |
| Molecular Formula | C12H10ClF3O2 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (3Z)-3-[(4-chlorophenyl)-hydroxymethylidene]-1,1,1-trifluoropentan-2-one |
| SMILES | CC/C(C(=O)C(F)(F)F)=C(/O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClF3O2/c1-2-9(11(18)12(14,15)16)10(17)7-3-5-8(13)6-4-7/h3-6,17H,2H2,1H3/b10-9- |
| InChIKey | VNJVMMGQNFBYSC-KTKRTIGZSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|