C10H12ClF3N2O2 — CID 24798854
1-[(4-chlorophenyl)methyl]-1-methylhydrazine;2,2,2-trifluoroacetic acid (PubChem CID 24798854) has the molecular formula C10H12ClF3N2O2 and a molecular weight of 284.67 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-methylhydrazine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-methylhydrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24798854 |
| Molecular Formula | C10H12ClF3N2O2 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-methylhydrazine;2,2,2-trifluoroacetic acid |
| SMILES | CN(N)Cc1ccc(Cl)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H11ClN2.C2HF3O2/c1-11(10)6-7-2-4-8(9)5-3-7;3-2(4,5)1(6)7/h2-5H,6,10H2,1H3;(H,6,7) |
| InChIKey | DIUQEPMZLAJQAI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|