C14H21ClN2O — CID 115157372
4-amino-N-[(4-chlorophenyl)methyl]-N,3,3-trimethylbutanamide (PubChem CID 115157372) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-amino-N-[(4-chlorophenyl)methyl]-N,3,3-trimethylbutanamide.
| Compound Name | 4-amino-N-[(4-chlorophenyl)methyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 115157372 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-amino-N-[(4-chlorophenyl)methyl]-N,3,3-trimethylbutanamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)CC(C)(C)CN |
| InChI | InChI=1S/C14H21ClN2O/c1-14(2,10-16)8-13(18)17(3)9-11-4-6-12(15)7-5-11/h4-7H,8-10,16H2,1-3H3 |
| InChIKey | RAWHIAXCOKAVBO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |