C17H28N2O — CID 64685652
3-amino-N-[(4-tert-butylphenyl)methyl]-N,3-dimethylbutanamide (PubChem CID 64685652) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-amino-N-[(4-tert-butylphenyl)methyl]-N,3-dimethylbutanamide.
| Compound Name | 3-amino-N-[(4-tert-butylphenyl)methyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 64685652 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3-amino-N-[(4-tert-butylphenyl)methyl]-N,3-dimethylbutanamide |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)C(=O)CC(C)(C)N |
| InChI | InChI=1S/C17H28N2O/c1-16(2,3)14-9-7-13(8-10-14)12-19(6)15(20)11-17(4,5)18/h7-10H,11-12,18H2,1-6H3 |
| InChIKey | SQCGOQZSHUTYPS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |