C16H21ClF6N2O5 — CID 46907950
4-chloro-2-[[2-(dimethylamino)ethyl-methylamino]methyl]phenol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 46907950) has the molecular formula C16H21ClF6N2O5 and a molecular weight of 470.79 g/mol. Its IUPAC name is 4-chloro-2-[[2-(dimethylamino)ethyl-methylamino]methyl]phenol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-chloro-2-[[2-(dimethylamino)ethyl-methylamino]methyl]phenol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 46907950 |
| Molecular Formula | C16H21ClF6N2O5 |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-chloro-2-[[2-(dimethylamino)ethyl-methylamino]methyl]phenol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN(C)Cc1cc(Cl)ccc1O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19ClN2O.2C2HF3O2/c1-14(2)6-7-15(3)9-10-8-11(13)4-5-12(10)16;2*3-2(4,5)1(6)7/h4-5,8,16H,6-7,9H2,1-3H3;2*(H,6,7) |
| InChIKey | ZBSLYCISOSALLI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|