C16H16ClNO3 — CID 65051860
4-[[(5-chloro-2-hydroxyphenyl)methyl-methylamino]methyl]benzoic acid (PubChem CID 65051860) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-[[(5-chloro-2-hydroxyphenyl)methyl-methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(5-chloro-2-hydroxyphenyl)methyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 65051860 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[[(5-chloro-2-hydroxyphenyl)methyl-methylamino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(C(=O)O)cc1)Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H16ClNO3/c1-18(10-13-8-14(17)6-7-15(13)19)9-11-2-4-12(5-3-11)16(20)21/h2-8,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | BRCJGHPJXXFIJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|