C11H16ClNO2 — CID 46840087
4-chloro-2-[[2-methoxyethyl(methyl)amino]methyl]phenol (PubChem CID 46840087) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-chloro-2-[[2-methoxyethyl(methyl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[2-methoxyethyl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 46840087 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-chloro-2-[[2-methoxyethyl(methyl)amino]methyl]phenol |
| SMILES | COCCN(C)Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H16ClNO2/c1-13(5-6-15-2)8-9-7-10(12)3-4-11(9)14/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | ZMHLYOQDFJQIDJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|