C14H17ClF3NO3 — CID 46840090
4-chloro-2-(piperidin-1-ylmethyl)phenol;2,2,2-trifluoroacetic acid (PubChem CID 46840090) has the molecular formula C14H17ClF3NO3 and a molecular weight of 339.74 g/mol. Its IUPAC name is 4-chloro-2-(piperidin-1-ylmethyl)phenol;2,2,2-trifluoroacetic acid.
| Compound Name | 4-chloro-2-(piperidin-1-ylmethyl)phenol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46840090 |
| Molecular Formula | C14H17ClF3NO3 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-chloro-2-(piperidin-1-ylmethyl)phenol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.Oc1ccc(Cl)cc1CN1CCCCC1 |
| InChI | InChI=1S/C12H16ClNO.C2HF3O2/c13-11-4-5-12(15)10(8-11)9-14-6-2-1-3-7-14;3-2(4,5)1(6)7/h4-5,8,15H,1-3,6-7,9H2;(H,6,7) |
| InChIKey | IVDAXJSMOJOAMG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|