C28H38N2O2 — CID 46240602
4-[(E)-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(piperidin-1-ylmethyl)phenol (PubChem CID 46240602) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 4-[(E)-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(piperidin-1-ylmethyl)phenol.
| Compound Name | 4-[(E)-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(piperidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 46240602 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 4-[(E)-3-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]but-2-en-2-yl]-2-(piperidin-1-ylmethyl)phenol |
| SMILES | C/C(=C(/C)c1ccc(O)c(CN2CCCCC2)c1)c1ccc(O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C28H38N2O2/c1-21(23-9-11-27(31)25(17-23)19-29-13-5-3-6-14-29)22(2)24-10-12-28(32)26(18-24)20-30-15-7-4-8-16-30/h9-12,17-18,31-32H,3-8,13-16,19-20H2,1-2H3/b22-21+ |
| InChIKey | JPQXEPFQNARVLU-QURGRASLSA-N |
| XLogP | 6.02 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|