C12H15Br2NO — CID 175396121
4,5-dibromo-2-(piperidin-1-ylmethyl)phenol (PubChem CID 175396121) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 4,5-dibromo-2-(piperidin-1-ylmethyl)phenol.
| Compound Name | 4,5-dibromo-2-(piperidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 175396121 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 4,5-dibromo-2-(piperidin-1-ylmethyl)phenol |
| SMILES | Oc1cc(Br)c(Br)cc1CN1CCCCC1 |
| InChI | InChI=1S/C12H15Br2NO/c13-10-6-9(12(16)7-11(10)14)8-15-4-2-1-3-5-15/h6-7,16H,1-5,8H2 |
| InChIKey | RJUKOERHDBOCKB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|