C20H21Br4NO4 — CID 167650255
4,5-dibromo-2-hydroxybenzaldehyde;4,5-dibromo-2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenol (PubChem CID 167650255) has the molecular formula C20H21Br4NO4 and a molecular weight of 659.01 g/mol. Its IUPAC name is 4,5-dibromo-2-hydroxybenzaldehyde;4,5-dibromo-2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenol.
| Compound Name | 4,5-dibromo-2-hydroxybenzaldehyde;4,5-dibromo-2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 167650255 |
| Molecular Formula | C20H21Br4NO4 |
| Molecular Weight | 659.01 g/mol |
| Exact Mass | 654.82 |
| IUPAC Name | 4,5-dibromo-2-hydroxybenzaldehyde;4,5-dibromo-2-[[4-(hydroxymethyl)piperidin-1-yl]methyl]phenol |
| SMILES | O=Cc1cc(Br)c(Br)cc1O.OCC1CCN(Cc2cc(Br)c(Br)cc2O)CC1 |
| InChI | InChI=1S/C13H17Br2NO2.C7H4Br2O2/c14-11-5-10(13(18)6-12(11)15)7-16-3-1-9(8-17)2-4-16;8-5-1-4(3-10)7(11)2-6(5)9/h5-6,9,17-18H,1-4,7-8H2;1-3,11H |
| InChIKey | QLXKYBQQTYTICS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|