C19H23BrN4O2 — CID 135839877
4-bromo-N-[(E)-1-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 135839877) has the molecular formula C19H23BrN4O2 and a molecular weight of 419.32 g/mol. Its IUPAC name is 4-bromo-N-[(E)-1-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(E)-1-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135839877 |
| Molecular Formula | C19H23BrN4O2 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-bromo-N-[(E)-1-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(Br)c[nH]1)c1ccc(O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C19H23BrN4O2/c1-13(22-23-19(26)17-10-16(20)11-21-17)14-5-6-18(25)15(9-14)12-24-7-3-2-4-8-24/h5-6,9-11,21,25H,2-4,7-8,12H2,1H3,(H,23,26)/b22-13+ |
| InChIKey | RFVRIGNCMZIOLL-LPYMAVHISA-N |
| XLogP | 3.62 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|