C23H25N5O3 — CID 9176977
N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9176977) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9176977 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2n[nH]c(=O)c3ccccc23)cc1CN1CCCC1 |
| InChI | InChI=1S/C23H25N5O3/c1-15(16-9-10-20(31-2)17(13-16)14-28-11-5-6-12-28)24-27-23(30)21-18-7-3-4-8-19(18)22(29)26-25-21/h3-4,7-10,13H,5-6,11-12,14H2,1-2H3,(H,26,29)(H,27,30)/b24-15- |
| InChIKey | CMPHTADZAVFGNZ-IWIPYMOSSA-N |
| XLogP | 2.68 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|