C19H16F2N4O3S — CID 166179270
N-[(E)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 166179270) has the molecular formula C19H16F2N4O3S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[(E)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(E)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 166179270 |
| Molecular Formula | C19H16F2N4O3S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[(E)-1-[4-(difluoromethylsulfanyl)-3-methoxyphenyl]ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)c2n[nH]c(=O)c3ccccc23)ccc1SC(F)F |
| InChI | InChI=1S/C19H16F2N4O3S/c1-10(11-7-8-15(29-19(20)21)14(9-11)28-2)22-25-18(27)16-12-5-3-4-6-13(12)17(26)24-23-16/h3-9,19H,1-2H3,(H,24,26)(H,25,27)/b22-10+ |
| InChIKey | IWHDKMCIDBJUOF-LSHDLFTRSA-N |
| XLogP | 3.40 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|