C17H11Cl2FN4O2 — CID 9176910
N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9176910) has the molecular formula C17H11Cl2FN4O2 and a molecular weight of 393.21 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9176910 |
| Molecular Formula | C17H11Cl2FN4O2 |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | C/C(=N/NC(=O)c1n[nH]c(=O)c2ccccc12)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2FN4O2/c1-8(11-6-14(20)13(19)7-12(11)18)21-24-17(26)15-9-4-2-3-5-10(9)16(25)23-22-15/h2-7H,1H3,(H,23,25)(H,24,26)/b21-8- |
| InChIKey | ROUMYRJFTOIIBM-WNFQYIGGSA-N |
| XLogP | 3.52 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|