C24H18Cl2N4O2 — CID 16555980
3-benzyl-N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide (PubChem CID 16555980) has the molecular formula C24H18Cl2N4O2 and a molecular weight of 465.34 g/mol. Its IUPAC name is 3-benzyl-N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 16555980 |
| Molecular Formula | C24H18Cl2N4O2 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 3-benzyl-N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
| SMILES | C/C(=N\NC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H18Cl2N4O2/c1-15(20-13-17(25)11-12-21(20)26)27-28-23(31)22-18-9-5-6-10-19(18)24(32)30(29-22)14-16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,28,31)/b27-15+ |
| InChIKey | VGGXIRCLQRSKRP-JFLMPSFJSA-N |
| XLogP | 4.91 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|