C26H23N5O3 — CID 4203071
N-[1-(3-acetamidophenyl)ethylideneamino]-3-benzyl-4-oxophthalazine-1-carboxamide (PubChem CID 4203071) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethylideneamino]-3-benzyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[1-(3-acetamidophenyl)ethylideneamino]-3-benzyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4203071 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethylideneamino]-3-benzyl-4-oxophthalazine-1-carboxamide |
| SMILES | CC(=O)Nc1cccc(C(C)=NNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C26H23N5O3/c1-17(20-11-8-12-21(15-20)27-18(2)32)28-29-25(33)24-22-13-6-7-14-23(22)26(34)31(30-24)16-19-9-4-3-5-10-19/h3-15H,16H2,1-2H3,(H,27,32)(H,29,33) |
| InChIKey | SMBXYQDYAFQLBN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|