C23H20N4O2S — CID 9175069
3-benzyl-4-oxo-N-[(Z)-1-thiophen-2-ylpropylideneamino]phthalazine-1-carboxamide (PubChem CID 9175069) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-benzyl-4-oxo-N-[(Z)-1-thiophen-2-ylpropylideneamino]phthalazine-1-carboxamide.
| Compound Name | 3-benzyl-4-oxo-N-[(Z)-1-thiophen-2-ylpropylideneamino]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9175069 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-benzyl-4-oxo-N-[(Z)-1-thiophen-2-ylpropylideneamino]phthalazine-1-carboxamide |
| SMILES | CC/C(=N/NC(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C23H20N4O2S/c1-2-19(20-13-8-14-30-20)24-25-22(28)21-17-11-6-7-12-18(17)23(29)27(26-21)15-16-9-4-3-5-10-16/h3-14H,2,15H2,1H3,(H,25,28)/b24-19- |
| InChIKey | IEFKMWAEOYUNSX-CLCOLTQESA-N |
| XLogP | 4.05 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|