C22H20N4O2 — CID 9175091
3-benzyl-N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-4-oxophthalazine-1-carboxamide (PubChem CID 9175091) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-benzyl-N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9175091 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-benzyl-N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-4-oxophthalazine-1-carboxamide |
| SMILES | CC1=C/C(=N/NC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H20N4O2/c1-15-11-12-17(13-15)23-24-21(27)20-18-9-5-6-10-19(18)22(28)26(25-20)14-16-7-3-2-4-8-16/h2-10,13H,11-12,14H2,1H3,(H,24,27)/b23-17+ |
| InChIKey | HDLJBWDHRBJTGN-HAVVHWLPSA-N |
| XLogP | 3.27 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|