C13H9BrCl2FN3O — CID 75535292
4-bromo-N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 75535292) has the molecular formula C13H9BrCl2FN3O and a molecular weight of 393.04 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75535292 |
| Molecular Formula | C13H9BrCl2FN3O |
| Molecular Weight | 393.04 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(Br)c[nH]1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H9BrCl2FN3O/c1-6(8-3-11(17)10(16)4-9(8)15)19-20-13(21)12-2-7(14)5-18-12/h2-5,18H,1H3,(H,20,21)/b19-6- |
| InChIKey | ZIAIPNWSVXECKN-SWNXQHNESA-N |
| XLogP | 4.38 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|