C14H11BrN4OS — CID 8983369
N-[(Z)-1-(1,3-benzothiazol-2-yl)ethylideneamino]-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 8983369) has the molecular formula C14H11BrN4OS and a molecular weight of 363.24 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzothiazol-2-yl)ethylideneamino]-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-1-(1,3-benzothiazol-2-yl)ethylideneamino]-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8983369 |
| Molecular Formula | C14H11BrN4OS |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | N-[(Z)-1-(1,3-benzothiazol-2-yl)ethylideneamino]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(Br)c[nH]1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11BrN4OS/c1-8(14-17-10-4-2-3-5-12(10)21-14)18-19-13(20)11-6-9(15)7-16-11/h2-7,16H,1H3,(H,19,20)/b18-8- |
| InChIKey | BNIWSFVKKDFPEB-LSCVHKIXSA-N |
| XLogP | 3.54 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|