C17H11BrN4O3S — CID 46524293
N'-[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]-4-bromo-1H-pyrrole-2-carbohydrazide (PubChem CID 46524293) has the molecular formula C17H11BrN4O3S and a molecular weight of 431.27 g/mol. Its IUPAC name is N'-[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]-4-bromo-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]-4-bromo-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 46524293 |
| Molecular Formula | C17H11BrN4O3S |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | N'-[5-(1,3-benzothiazol-2-yl)furan-2-carbonyl]-4-bromo-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(-c2nc3ccccc3s2)o1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C17H11BrN4O3S/c18-9-7-11(19-8-9)15(23)21-22-16(24)12-5-6-13(25-12)17-20-10-3-1-2-4-14(10)26-17/h1-8,19H,(H,21,23)(H,22,24) |
| InChIKey | DLYWBWISHGQCEK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|