C13H11BrClN3O — CID 8982528
4-bromo-N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8982528) has the molecular formula C13H11BrClN3O and a molecular weight of 340.61 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982528 |
| Molecular Formula | C13H11BrClN3O |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(Br)c[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C13H11BrClN3O/c1-8(10-4-2-3-5-11(10)15)17-18-13(19)12-6-9(14)7-16-12/h2-7,16H,1H3,(H,18,19)/b17-8- |
| InChIKey | ZNBAKZBSGDTHQR-IUXPMGMMSA-N |
| XLogP | 3.58 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|