C11H9Br2N3OS — CID 8982536
4-bromo-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8982536) has the molecular formula C11H9Br2N3OS and a molecular weight of 391.09 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8982536 |
| Molecular Formula | C11H9Br2N3OS |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(Br)c[nH]1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H9Br2N3OS/c1-6(9-2-3-10(13)18-9)15-16-11(17)8-4-7(12)5-14-8/h2-5,14H,1H3,(H,16,17)/b15-6- |
| InChIKey | CAAAUJWFYROLAJ-UUASQNMZSA-N |
| XLogP | 3.76 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|