C16H17BrN2O4S — CID 3537672
N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 3537672) has the molecular formula C16H17BrN2O4S and a molecular weight of 413.29 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3537672 |
| Molecular Formula | C16H17BrN2O4S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NN=C(C)c2ccc(Br)s2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17BrN2O4S/c1-9(13-5-6-14(17)24-13)18-19-16(20)10-7-11(21-2)15(23-4)12(8-10)22-3/h5-8H,1-4H3,(H,19,20) |
| InChIKey | OGBUUAJTTNZCLA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|