C11H10BrN3OS — CID 9025434
N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 9025434) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9025434 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | N-[(Z)-1-(5-bromothiophen-2-yl)ethylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc[nH]1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H10BrN3OS/c1-7(9-4-5-10(12)17-9)14-15-11(16)8-3-2-6-13-8/h2-6,13H,1H3,(H,15,16)/b14-7- |
| InChIKey | JDJUZSWPVPEHLN-AUWJEWJLSA-N |
| XLogP | 2.99 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|