C15H9Br2ClN2OS2 — CID 4987910
6-bromo-N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 4987910) has the molecular formula C15H9Br2ClN2OS2 and a molecular weight of 492.65 g/mol. Its IUPAC name is 6-bromo-N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | 6-bromo-N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4987910 |
| Molecular Formula | C15H9Br2ClN2OS2 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 489.82 |
| IUPAC Name | 6-bromo-N-[1-(5-bromothiophen-2-yl)ethylideneamino]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1sc2cc(Br)ccc2c1Cl)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H9Br2ClN2OS2/c1-7(10-4-5-12(17)22-10)19-20-15(21)14-13(18)9-3-2-8(16)6-11(9)23-14/h2-6H,1H3,(H,20,21) |
| InChIKey | PLICBIILQSQTDL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|