C16H12BrClN2OS2 — CID 6029011
6-bromo-3-chloro-N-[(Z)-1-thiophen-2-ylpropylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6029011) has the molecular formula C16H12BrClN2OS2 and a molecular weight of 427.78 g/mol. Its IUPAC name is 6-bromo-3-chloro-N-[(Z)-1-thiophen-2-ylpropylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-bromo-3-chloro-N-[(Z)-1-thiophen-2-ylpropylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6029011 |
| Molecular Formula | C16H12BrClN2OS2 |
| Molecular Weight | 427.78 g/mol |
| Exact Mass | 425.93 |
| IUPAC Name | 6-bromo-3-chloro-N-[(Z)-1-thiophen-2-ylpropylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC/C(=N/NC(=O)c1sc2cc(Br)ccc2c1Cl)c1cccs1 |
| InChI | InChI=1S/C16H12BrClN2OS2/c1-2-11(12-4-3-7-22-12)19-20-16(21)15-14(18)10-6-5-9(17)8-13(10)23-15/h3-8H,2H2,1H3,(H,20,21)/b19-11- |
| InChIKey | KCIJVRZZINRXKP-ODLFYWEKSA-N |
| XLogP | 5.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.78 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|