C21H20Cl2N2OS — CID 4161371
N-[1-(4-tert-butylphenyl)ethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 4161371) has the molecular formula C21H20Cl2N2OS and a molecular weight of 419.38 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4161371 |
| Molecular Formula | C21H20Cl2N2OS |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1sc2cc(Cl)ccc2c1Cl)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H20Cl2N2OS/c1-12(13-5-7-14(8-6-13)21(2,3)4)24-25-20(26)19-18(23)16-10-9-15(22)11-17(16)27-19/h5-11H,1-4H3,(H,25,26) |
| InChIKey | ZVRATACDVDVJLK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|