C20H15ClF3N3O2S — CID 6293578
3-chloro-6-methyl-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 6293578) has the molecular formula C20H15ClF3N3O2S and a molecular weight of 453.87 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6293578 |
| Molecular Formula | C20H15ClF3N3O2S |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 3-chloro-6-methyl-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1sc2cc(C)ccc2c1Cl)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O2S/c1-10-3-8-14-15(9-10)30-17(16(14)21)18(28)27-26-11(2)12-4-6-13(7-5-12)25-19(29)20(22,23)24/h3-9H,1-2H3,(H,25,29)(H,27,28)/b26-11- |
| InChIKey | JGDBJKFTYWMNIL-RAWMCFOBSA-N |
| XLogP | 5.52 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|