C24H19Cl2N3O2S2 — CID 28740425
3-chloro-N-[(Z)-1-[4-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-6-ethyl-1-benzothiophene-2-carboxamide (PubChem CID 28740425) has the molecular formula C24H19Cl2N3O2S2 and a molecular weight of 516.48 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-1-[4-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-6-ethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(Z)-1-[4-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-6-ethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 28740425 |
| Molecular Formula | C24H19Cl2N3O2S2 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 3-chloro-N-[(Z)-1-[4-[(5-chlorothiophene-2-carbonyl)amino]phenyl]ethylideneamino]-6-ethyl-1-benzothiophene-2-carboxamide |
| SMILES | CCc1ccc2c(Cl)c(C(=O)N/N=C(/C)c3ccc(NC(=O)c4ccc(Cl)s4)cc3)sc2c1 |
| InChI | InChI=1S/C24H19Cl2N3O2S2/c1-3-14-4-9-17-19(12-14)33-22(21(17)26)24(31)29-28-13(2)15-5-7-16(8-6-15)27-23(30)18-10-11-20(25)32-18/h4-12H,3H2,1-2H3,(H,27,30)(H,29,31)/b28-13- |
| InChIKey | VRCIQIXWGPDVAH-QDTIIGTASA-N |
| XLogP | 7.24 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|