C25H18Cl3N3O2S — CID 4643104
3-chloro-N-[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 4643104) has the molecular formula C25H18Cl3N3O2S and a molecular weight of 530.86 g/mol. Its IUPAC name is 3-chloro-N-[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4643104 |
| Molecular Formula | C25H18Cl3N3O2S |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | 3-chloro-N-[1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1sc2cc(C)ccc2c1Cl)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H18Cl3N3O2S/c1-13-3-9-19-21(11-13)34-23(22(19)28)25(33)31-30-14(2)15-4-7-17(8-5-15)29-24(32)18-10-6-16(26)12-20(18)27/h3-12H,1-2H3,(H,29,32)(H,31,33) |
| InChIKey | VKFATIUWLGTFAE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|