C19H12Cl2F3N3O2S — CID 17338158
3,4-dichloro-N-[(E)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 17338158) has the molecular formula C19H12Cl2F3N3O2S and a molecular weight of 474.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[(E)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4-dichloro-N-[(E)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17338158 |
| Molecular Formula | C19H12Cl2F3N3O2S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 3,4-dichloro-N-[(E)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1sc2cccc(Cl)c2c1Cl)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12Cl2F3N3O2S/c1-9(10-5-7-11(8-6-10)25-18(29)19(22,23)24)26-27-17(28)16-15(21)14-12(20)3-2-4-13(14)30-16/h2-8H,1H3,(H,25,29)(H,27,28)/b26-9+ |
| InChIKey | WSHVJTXPSJHGQS-JQAMDZJQSA-N |
| XLogP | 5.86 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|