C14H15Cl2FN2O3S — CID 8868131
N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8868131) has the molecular formula C14H15Cl2FN2O3S and a molecular weight of 381.26 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8868131 |
| Molecular Formula | C14H15Cl2FN2O3S |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-[(Z)-1-(2,4-dichloro-5-fluorophenyl)ethylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | C/C(=N/NC(=O)C[C@H]1CCS(=O)(=O)C1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2FN2O3S/c1-8(10-5-13(17)12(16)6-11(10)15)18-19-14(20)4-9-2-3-23(21,22)7-9/h5-6,9H,2-4,7H2,1H3,(H,19,20)/b18-8-/t9-/m1/s1 |
| InChIKey | BEPFNNHADTVYGW-YSUMALLGSA-N |
| XLogP | 2.80 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|