C21H24N2O4S — CID 8867807
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]acetamide (PubChem CID 8867807) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 8867807 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-1-(4-phenylmethoxyphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)C[C@@H]1CCS(=O)(=O)C1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-16(22-23-21(24)13-18-11-12-28(25,26)15-18)19-7-9-20(10-8-19)27-14-17-5-3-2-4-6-17/h2-10,18H,11-15H2,1H3,(H,23,24)/b22-16-/t18-/m0/s1 |
| InChIKey | DDZOMHNLAOTCMR-PSRBBBRCSA-N |
| XLogP | 2.93 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|