C13H14BrFN2O3S — CID 8868499
N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8868499) has the molecular formula C13H14BrFN2O3S and a molecular weight of 377.24 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8868499 |
| Molecular Formula | C13H14BrFN2O3S |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | N-[(Z)-(5-bromo-2-fluorophenyl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)N/N=C\c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H14BrFN2O3S/c14-11-1-2-12(15)10(6-11)7-16-17-13(18)5-9-3-4-21(19,20)8-9/h1-2,6-7,9H,3-5,8H2,(H,17,18)/b16-7-/t9-/m1/s1 |
| InChIKey | QBPCQJMGCYBPRG-UIKYOSCFSA-N |
| XLogP | 1.86 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|