C15H17BrN2O3S — CID 84858367
N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 84858367) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 84858367 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NN=CC(Br)=Cc1ccccc1 |
| InChI | InChI=1S/C15H17BrN2O3S/c16-14(8-12-4-2-1-3-5-12)10-17-18-15(19)9-13-6-7-22(20,21)11-13/h1-5,8,10,13H,6-7,9,11H2,(H,18,19) |
| InChIKey | GDAHHENAKRCWLY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|