C12H15N3O3S — CID 8865429
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide (PubChem CID 8865429) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 8865429 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(Z)-pyridin-3-ylmethylideneamino]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)N/N=C\c1cccnc1 |
| InChI | InChI=1S/C12H15N3O3S/c16-12(6-10-3-5-19(17,18)9-10)15-14-8-11-2-1-4-13-7-11/h1-2,4,7-8,10H,3,5-6,9H2,(H,15,16)/b14-8-/t10-/m0/s1 |
| InChIKey | SEBLNVMCMBOQGH-WULZRQGASA-N |
| XLogP | 0.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|