C13H14Cl2N2O3S — CID 8865973
N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8865973) has the molecular formula C13H14Cl2N2O3S and a molecular weight of 349.24 g/mol. Its IUPAC name is N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8865973 |
| Molecular Formula | C13H14Cl2N2O3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3S/c14-11-3-1-2-10(13(11)15)7-16-17-12(18)6-9-4-5-21(19,20)8-9/h1-3,7,9H,4-6,8H2,(H,17,18)/b16-7-/t9-/m0/s1 |
| InChIKey | ZSKMVPNAUBCUQE-JUAVFEPTSA-N |
| XLogP | 2.27 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|