C14H15ClN2O5S — CID 8869389
N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8869389) has the molecular formula C14H15ClN2O5S and a molecular weight of 358.80 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8869389 |
| Molecular Formula | C14H15ClN2O5S |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)N/N=C\c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H15ClN2O5S/c15-11-3-10(4-12-14(11)22-8-21-12)6-16-17-13(18)5-9-1-2-23(19,20)7-9/h3-4,6,9H,1-2,5,7-8H2,(H,17,18)/b16-6-/t9-/m1/s1 |
| InChIKey | ASBXEYGVPXHJIM-DYCBTQOFSA-N |
| XLogP | 1.34 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|