C14H17ClN2O5S — CID 135776796
N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 135776796) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 135776796 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[(E)-(3-chloro-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)C[C@@H]2CCS(=O)(=O)C2)cc(Cl)c1O |
| InChI | InChI=1S/C14H17ClN2O5S/c1-22-12-5-10(4-11(15)14(12)19)7-16-17-13(18)6-9-2-3-23(20,21)8-9/h4-5,7,9,19H,2-3,6,8H2,1H3,(H,17,18)/b16-7+/t9-/m0/s1 |
| InChIKey | FOHBKZQLXUFBLE-UVSFYCKTSA-N |
| XLogP | 1.33 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|