C13H15ClN2O3 — CID 9154143
N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-methylbutanamide (PubChem CID 9154143) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-methylbutanamide.
| Compound Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 9154143 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)N/N=C\c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H15ClN2O3/c1-8(2)3-12(17)16-15-6-9-4-10(14)13-11(5-9)18-7-19-13/h4-6,8H,3,7H2,1-2H3,(H,16,17)/b15-6- |
| InChIKey | WGPVPHNOSOWJRX-UUASQNMZSA-N |
| XLogP | 2.56 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|