C14H10ClFN2O2 — CID 9143088
N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-fluoroaniline (PubChem CID 9143088) has the molecular formula C14H10ClFN2O2 and a molecular weight of 292.70 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-fluoroaniline.
| Compound Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-fluoroaniline |
|---|---|
| PubChem CID | 9143088 |
| Molecular Formula | C14H10ClFN2O2 |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-fluoroaniline |
| SMILES | Fc1ccc(N/N=C\c2cc(Cl)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C14H10ClFN2O2/c15-12-5-9(6-13-14(12)20-8-19-13)7-17-18-11-3-1-10(16)2-4-11/h1-7,18H,8H2/b17-7- |
| InChIKey | KRPGAHZLBMMHDX-IDUWFGFVSA-N |
| XLogP | 3.65 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|