C12H10ClN3O2S — CID 168617902
N-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617902) has the molecular formula C12H10ClN3O2S and a molecular weight of 295.75 g/mol. Its IUPAC name is N-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617902 |
| Molecular Formula | C12H10ClN3O2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cc(Cl)c3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H10ClN3O2S/c1-7-5-19-12(15-7)16-14-4-8-2-9(13)11-10(3-8)17-6-18-11/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | MYXDMLRABQAWRH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|