C14H9BrF2N2O2 — CID 9058269
N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2,4-difluoroaniline (PubChem CID 9058269) has the molecular formula C14H9BrF2N2O2 and a molecular weight of 355.14 g/mol. Its IUPAC name is N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2,4-difluoroaniline.
| Compound Name | N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 9058269 |
| Molecular Formula | C14H9BrF2N2O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-[(Z)-(7-bromo-1,3-benzodioxol-5-yl)methylideneamino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(N/N=C\c2cc(Br)c3c(c2)OCO3)c(F)c1 |
| InChI | InChI=1S/C14H9BrF2N2O2/c15-10-3-8(4-13-14(10)21-7-20-13)6-18-19-12-2-1-9(16)5-11(12)17/h1-6,19H,7H2/b18-6- |
| InChIKey | PKICZJVIRAJJRM-FXBPXSCXSA-N |
| XLogP | 3.90 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|