C13H8Br2F2N2O — CID 135548670
2,6-dibromo-4-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135548670) has the molecular formula C13H8Br2F2N2O and a molecular weight of 406.02 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135548670 |
| Molecular Formula | C13H8Br2F2N2O |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 2,6-dibromo-4-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(/C=N/Nc2ccc(F)cc2F)cc1Br |
| InChI | InChI=1S/C13H8Br2F2N2O/c14-9-3-7(4-10(15)13(9)20)6-18-19-12-2-1-8(16)5-11(12)17/h1-6,19-20H/b18-6+ |
| InChIKey | VJRIUAJUARCHED-NGYBGAFCSA-N |
| XLogP | 4.64 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|